| ID | 9411 |
| Metal | Au |
| Oxidation state | 3 |
| Charge | 0 |
| Donor atoms | {"O": 7, "N": 1} |
| Abbreviation | — |
| SMILES | [CH2-]Cc1ccc(OCCO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1.[c-]1ccccc1-c1cccc(-c2[c-]cccc2)n1 |
| Cell line | IC₅₀ dark (µM) | IC₅₀ light (µM) | DOI | Year |
| HepG2 | 22 | 0.84 | 10.1002/anie.202201103 | 2022 |
| HCT-116 | 26 | 0.79 | 10.1002/anie.202201103 | 2022 |
| A375 | 31 | 0.69 | 10.1002/anie.202201103 | 2022 |
| MCF-7 | 40 | 1.6 | 10.1002/anie.202201103 | 2022 |
| MDA-MB-231 | 66 | 1.9 | 10.1002/anie.202201103 | 2022 |
| A549 | 1e+02 | 1.4 | 10.1002/anie.202201103 | 2022 |
Builds the drawing from source ligand graphs and explicit donor metadata, then uses Metal2D only for layout. Publication output uses black bonds without arrows or colour highlighting; validated octahedral enantiomers are encoded directly with solid and hashed wedge bonds.