| ID | 9397 |
| Metal | Ir |
| Oxidation state | 3 |
| Charge | 1 |
| Donor atoms | {"N": 4, "O": 2} |
| Abbreviation | — |
| SMILES | Cc1ccnc(-c2cc(C(=O)O)ccn2)c1.[c-]1ccccc1-c1ccc2ccccc2n1.[c-]1ccccc1-c1ccc2ccccc2n1 |
| Cell line | IC₅₀ dark (µM) | IC₅₀ light (µM) | DOI | Year |
| MCF-7 | 2.8 | 0.08 | 10.1021/acs.inorgchem.5c05154 | 2025 |
| A549 | 3.8 | 0.08 | 10.1021/acs.inorgchem.5c05154 | 2025 |
| A2780 | 4.5 | 0.11 | 10.1021/acs.inorgchem.5c05154 | 2025 |
| A2780cisR | 4.5 | 0.15 | 10.1021/acs.inorgchem.5c05154 | 2025 |
| HEK293 | 8.7 | 1.1 | 10.1021/acs.inorgchem.5c05154 | 2025 |
Builds the drawing from source ligand graphs and explicit donor metadata, then uses Metal2D only for layout. Publication output uses black bonds without arrows or colour highlighting; validated octahedral enantiomers are encoded directly with solid and hashed wedge bonds.