| ID | 9250 |
| Metal | Au |
| Oxidation state | 3 |
| Charge | 0 |
| Donor atoms | {"O": 2, "N": 1} |
| Abbreviation | — |
| SMILES | OCCC1(CCO)c2ccccc2-c2c[c-]c(-c3cc4ccccc4cn3)cc21.[C-]#Cc1ccccc1.[C-]#Cc1ccccc1 |
| Cell line | IC₅₀ dark (µM) | IC₅₀ light (µM) | DOI | Year |
| A375 | 1e+02 | 0.47 | 10.1002/anie.202212689 | 2022 |
| HCT-116 | 1e+02 | 0.65 | 10.1002/anie.202212689 | 2022 |
| A549 | 1e+02 | 1.2 | 10.1002/anie.202212689 | 2022 |
| HepG2 | 1e+02 | 0.9 | 10.1002/anie.202212689 | 2022 |
Builds the drawing from source ligand graphs and explicit donor metadata, then uses Metal2D only for layout. Publication output uses black bonds without arrows or colour highlighting; validated octahedral enantiomers are encoded directly with solid and hashed wedge bonds.