| ID | 9070 |
| Metal | Ir |
| Oxidation state | 3 |
| Charge | 1 |
| Donor atoms | {"O": 2, "N": 7, "S": 1, "F": 9} |
| Abbreviation | — |
| SMILES | COC(=O)c1ccc2c(c1)nc(-c1nc3ccccc3s1)n2Cc1ccc(C(F)(F)F)cc1.FC(F)(F)c1ccc(Cn2c(-c3[c-]cccc3)nc3ccccc32)cc1.FC(F)(F)c1ccc(Cn2c(-c3[c-]cccc3)nc3ccccc32)cc1 |
| Cell line | IC₅₀ dark (µM) | IC₅₀ light (µM) | DOI | Year |
| HCC827-Gas-Luc2 | 13 | 4.2 | 10.1021/acs.jmedchem.5c03280 | 2026 |
| MRC-5 | 13 | — | 10.1021/acs.jmedchem.5c03280 | 2026 |
| HCT-116 | 32 | 2.7 | 10.1021/acs.jmedchem.5c03280 | 2026 |
| A549 | 53 | 41 | 10.1021/acs.jmedchem.5c03280 | 2026 |
Builds the drawing from source ligand graphs and explicit donor metadata, then uses Metal2D only for layout. Publication output uses black bonds without arrows or colour highlighting; validated octahedral enantiomers are encoded directly with solid and hashed wedge bonds.