| ID | 8991 |
| Metal | Ir |
| Oxidation state | 3 |
| Charge | 0 |
| Donor atoms | {"S": 2, "N": 6} |
| Abbreviation | — |
| SMILES | [S-]c1nc2ccccc2c2n1nc([S-])[n+]2-c1ccccc1.[c-]1cccc2ccc3cccnc3c12.[c-]1cccc2ccc3cccnc3c12 |
| Cell line | IC₅₀ dark (µM) | IC₅₀ light (µM) | DOI | Year |
| A549 | 50 | 0.0019 | 10.1039/d5sc04772b | 2025 |
| HeLa | 50 | 0.0015 | 10.1039/d5sc04772b | 2025 |
| MRC9 | 50 | 50 | 10.1039/d5sc04772b | 2025 |
Builds the drawing from source ligand graphs and explicit donor metadata, then uses Metal2D only for layout. Publication output uses black bonds without arrows or colour highlighting; validated octahedral enantiomers are encoded directly with solid and hashed wedge bonds.