| ID | 8867 |
| Metal | Ir |
| Oxidation state | 3 |
| Charge | 2 |
| Donor atoms | {"N": 4, "O": 2, "P": 1} |
| Abbreviation | — |
| SMILES | Cc1ccnc(-c2cc(C(=O)OCCCC[P+](c3ccccc3)(c3ccccc3)c3ccccc3)ccn2)c1.[c-]1ccccc1-c1ccc2ccccc2n1.[c-]1ccccc1-c1ccc2ccccc2n1 |
| Cell line | IC₅₀ dark (µM) | IC₅₀ light (µM) | DOI | Year |
| A2780cisR | 3.4 | 0.09 | 10.1021/acs.inorgchem.5c05154 | 2025 |
| MCF-7 | 3.8 | 0.06 | 10.1021/acs.inorgchem.5c05154 | 2025 |
| A549 | 4.1 | 0.22 | 10.1021/acs.inorgchem.5c05154 | 2025 |
| A2780 | 4.8 | 0.07 | 10.1021/acs.inorgchem.5c05154 | 2025 |
| HEK293 | 7.3 | 0.93 | 10.1021/acs.inorgchem.5c05154 | 2025 |
Builds the drawing from source ligand graphs and explicit donor metadata, then uses Metal2D only for layout. Publication output uses black bonds without arrows or colour highlighting; validated octahedral enantiomers are encoded directly with solid and hashed wedge bonds.