| ID | 7840 |
| Metal | Au |
| Oxidation state | 3 |
| Charge | 0 |
| Donor atoms | {"N": 1, "O": 7} |
| Abbreviation | — |
| SMILES | Cc1c[c-]c(-c2cccc(-c3[c-]cc(C)cc3)n2)cc1.[CH2-]Cc1ccc(OCCO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| Cell line | IC₅₀ dark (µM) | IC₅₀ light (µM) | DOI | Year |
| HCT-116 | 1e+02 | 0.25 | 10.1002/anie.202201103 | 2022 |
| A375 | 1e+02 | 0.3 | 10.1002/anie.202201103 | 2022 |
| HepG2 | 1e+02 | 0.37 | 10.1002/anie.202201103 | 2022 |
| A549 | 1e+02 | 0.44 | 10.1002/anie.202201103 | 2022 |
| MCF-7 | 1e+02 | 0.72 | 10.1002/anie.202201103 | 2022 |
| MDA-MB-231 | 1.1e+02 | 0.42 | 10.1002/anie.202201103 | 2022 |
Builds the drawing from source ligand graphs and explicit donor metadata, then uses Metal2D only for layout. Publication output uses black bonds without arrows or colour highlighting; validated octahedral enantiomers are encoded directly with solid and hashed wedge bonds.