| ID | 784 |
| Metal | Ru |
| Oxidation state | 2 |
| Charge | 1 |
| Donor atoms | {"N": 5} |
| Abbreviation | Ru1 |
| SMILES | COc1cc2c(cc1OC)C(c1[c-]cccc1)=NCC2.c1ccc(-c2ccccn2)nc1.c1ccc(-c2ccccn2)nc1 |
| Cell line | IC₅₀ dark (µM) | IC₅₀ light (µM) | DOI | Year |
| Hs578T | 1.1 | 0.5 | 10.1039/d4md00600c | 2024 |
| MCF-10A | 1.2 | 0.4 | 10.1039/d4md00600c | 2024 |
| A375 | 1.4 | 0.6 | 10.1039/d4md00600c | 2024 |
Builds the drawing from source ligand graphs and explicit donor metadata, then uses Metal2D only for layout. Publication output uses black bonds without arrows or colour highlighting; validated octahedral enantiomers are encoded directly with solid and hashed wedge bonds.