| ID | 7771 |
| Metal | Ir |
| Oxidation state | 3 |
| Charge | 1 |
| Donor atoms | {"O": 1, "N": 6} |
| Abbreviation | — |
| SMILES | Cc1cc(O)ccc1-c1nc2c3cccnc3c3ncccc3c2[nH]1.[c-]1ccccc1-c1ccccn1.[c-]1ccccc1-c1ccccn1 |
| Cell line | IC₅₀ dark (µM) | IC₅₀ light (µM) | DOI | Year |
| A549 | 23 | 16 | 10.1039/d5dt00899a | 2025 |
| B16 | 29 | 3.1 | 10.1039/d5dt00899a | 2025 |
| HepG2 | 30 | 9.3 | 10.1039/d5dt00899a | 2025 |
| NIH-3T3 | 1e+02 | 1e+02 | 10.1039/d5dt00899a | 2025 |
Builds the drawing from source ligand graphs and explicit donor metadata, then uses Metal2D only for layout. Publication output uses black bonds without arrows or colour highlighting; validated octahedral enantiomers are encoded directly with solid and hashed wedge bonds.