| ID | 7325 |
| Metal | Au |
| Oxidation state | 3 |
| Charge | 0 |
| Donor atoms | {"N": 1} |
| Abbreviation | — |
| SMILES | [CH2-]CC.[c-]1ccccc1-c1cccc(-c2[c-]cccc2)n1 |
| Cell line | IC₅₀ dark (µM) | IC₅₀ light (µM) | DOI | Year |
| HCT-116 | 1e+02 | 1.4 | 10.1002/anie.202201103 | 2022 |
| A375 | 1e+02 | 1.6 | 10.1002/anie.202201103 | 2022 |
| HepG2 | 1e+02 | 3.4 | 10.1002/anie.202201103 | 2022 |
| A549 | 1e+02 | 3.9 | 10.1002/anie.202201103 | 2022 |
| MCF-7 | 1e+02 | 4.6 | 10.1002/anie.202201103 | 2022 |
| MDA-MB-231 | 1.1e+02 | 2.3 | 10.1002/anie.202201103 | 2022 |
Builds the drawing from source ligand graphs and explicit donor metadata, then uses Metal2D only for layout. Publication output uses black bonds without arrows or colour highlighting; validated octahedral enantiomers are encoded directly with solid and hashed wedge bonds.