| ID | 6779 |
| Metal | Rh |
| Oxidation state | 3 |
| Charge | 0 |
| Donor atoms | {"P": 1} |
| Abbreviation | 2 |
| SMILES | Cc1c(C)c(C)[c-](C)c1C.[Cl-].[c-]1cc2cccc3ccc4ccc(P(c5ccccc5)c5ccccc5)c1c4c23 |
| Cell line | IC₅₀ dark (µM) | IC₅₀ light (µM) | DOI | Year |
| HMLER | 0.63 | — | 10.1039/d4qi02763a | 2025 |
| BEAS-2B | 2.2 | — | 10.1039/d4qi02763a | 2025 |
Builds the drawing from source ligand graphs and explicit donor metadata, then uses Metal2D only for layout. Publication output uses black bonds without arrows or colour highlighting; validated octahedral enantiomers are encoded directly with solid and hashed wedge bonds.