| ID | 6469 |
| Metal | Os |
| Oxidation state | 2 |
| Charge | 0 |
| Donor atoms | {"O": 1} |
| Abbreviation | OsCUR-2 |
| SMILES | COc1cc(/C=C/C(=O)/C=C([O-])/C=C/c2ccc(O)c(OC)c2)ccc1O.[Cl-].c1ccc(-c2ccccc2)cc1 |
| Cell line | IC₅₀ dark (µM) | IC₅₀ light (µM) | DOI | Year |
| A549cisR | 89 | 2.6 | 10.1021/acs.inorgchem.1c00241 | 2021 |
| A549 | 1.4e+02 | 5.8 | 10.1021/acs.inorgchem.1c00241 | 2021 |
| HLF | 1.8e+02 | 45 | 10.1021/acs.inorgchem.1c00241 | 2021 |
Builds the drawing from source ligand graphs and explicit donor metadata, then uses Metal2D only for layout. Publication output uses black bonds without arrows or colour highlighting; validated octahedral enantiomers are encoded directly with solid and hashed wedge bonds.