| ID | 6100 |
| Metal | Ir |
| Oxidation state | 3 |
| Charge | 1 |
| Donor atoms | {"N": 6} |
| Abbreviation | IrL2 |
| SMILES | [c-]1ccccc1-c1nccc2c1[nH]c1ccccc12.[c-]1ccccc1-c1nccc2c1[nH]c1ccccc12.c1cnc2c(c1)ccc1cccnc12 |
| Cell line | IC₅₀ dark (µM) | IC₅₀ light (µM) | DOI | Year |
| A549 | 0.48 | 0.046 | 10.1039/d4dt00390j | 2024 |
| PC-3 | 1.7 | 0.25 | 10.1039/d4dt00390j | 2024 |
| HeLa | 5.6 | 0.33 | 10.1039/d4dt00390j | 2024 |
| MRC-5 | 7.6 | 0.39 | 10.1039/d4dt00390j | 2024 |
Builds the drawing from source ligand graphs and explicit donor metadata, then uses Metal2D only for layout. Publication output uses black bonds without arrows or colour highlighting; validated octahedral enantiomers are encoded directly with solid and hashed wedge bonds.