Info
| ID | 6098 |
| Metal | Ir |
| Oxidation state | 3 |
| Charge | 1 |
| Donor atoms | {"N": 6} |
| Abbreviation | Ir-dfppy-Tz |
| SMILES | Cc1nnc(-c2ccc(-c3nc4c5cccnc5c5ncccc5c4n3-c3ccccc3)cc2)nn1.Fc1c[c-]c(-c2ccccn2)c(F)c1.Fc1c[c-]c(-c2ccccn2)c(F)c1 |
TUCAN
C50H30F4IrN10/(1-36)(2-38)(3-65)(4-42)(5-39)(6-51)(7-31)(8-66)(9-48)(10-41)(11-40)(12-53)(13-50)(14-34)(15-45)(16-43)(17-35)(18-55)(19-63)(20-44)(21-31)(22-52)(23-47)(24-46)(25-49)(26-37)(27-56)(28-31)(29-54)(30-64)(31-74)(32-36)(32-57)(33-51)(33-62)(34-44)(34-50)(35-40)(35-63)(36-77)(37-46)(37-64)(38-40)(38-67)(39-77)(39-78)(41-45)(41-59)(42-43)(42-60)(43-65)(44-69)(45-58)(46-53)(47-79)(47-80)(48-54)(48-66)(49-55)(49-58)(50-56)(51-80)(52-56)(52-69)(53-71)(54-61)(55-59)(57-67)(57-78)(58-75)(59-76)(60-68)(60-72)(61-70)(61-73)(62-71)(62-79)(63-87)(64-88)(65-83)(66-81)(67-87)(68-73)(68-82)(69-84)(70-72)(70-81)(71-88)(72-83)(73-84)(74-85)(74-89)(75-82)(75-84)(76-86)(76-90)(77-91)(78-92)(79-93)(80-94)(85-86)(87-95)(88-95)(89-90)(89-95)(90-95)
Measurements (4)
| Cell line | IC₅₀ dark (µM) | IC₅₀ light (µM) | DOI | Year |
| MDA-MB-231 | 7.3 | 0.09 | 10.1039/d4dt01665c | 2024 |
| HeLa | 7.9 | 0.084 | 10.1039/d4dt01665c | 2024 |
| A549 | 11 | 0.058 | 10.1039/d4dt01665c | 2024 |
| HLF | 16 | 0.31 | 10.1039/d4dt01665c | 2024 |
🧬 Cell Death Types (1)
Apoptosis
high
«When receiving a low-dose one- or two-photon PDT, they become highly potent towards A549 lung cancer cells (with IC50 values ranging from 24.0 nM to 96.0 nM) through the generation of reactive oxygen ...»
Source-assisted 2D generator
Builds the drawing from source ligand graphs and explicit donor metadata, then uses Metal2D only for layout. Publication output uses black bonds without arrows or colour highlighting; validated octahedral enantiomers are encoded directly with solid and hashed wedge bonds.
Loading source metadata…
The generated SVG will appear here. The legacy ligand image above stays visible for side-by-side review.