| ID | 6097 |
| Metal | Ir |
| Oxidation state | 3 |
| Charge | 1 |
| Donor atoms | {"N": 6} |
| Abbreviation | Ir-pbt-Tz |
| SMILES | Cc1nnc(-c2ccc(-c3nc4c5cccnc5c5ncccc5c4n3-c3ccccc3)cc2)nn1.[c-]1ccccc1-c1nc2ccccc2s1.[c-]1ccccc1-c1nc2ccccc2s1 |
| Cell line | IC₅₀ dark (µM) | IC₅₀ light (µM) | DOI | Year |
| HeLa | 6.4 | 0.043 | 10.1039/d4dt01665c | 2024 |
| MDA-MB-231 | 8.1 | 0.052 | 10.1039/d4dt01665c | 2024 |
| A549 | 8.4 | 0.024 | 10.1039/d4dt01665c | 2024 |
| HLF | 17 | 0.014 | 10.1039/d4dt01665c | 2024 |
Builds the drawing from source ligand graphs and explicit donor metadata, then uses Metal2D only for layout. Publication output uses black bonds without arrows or colour highlighting; validated octahedral enantiomers are encoded directly with solid and hashed wedge bonds.