| ID | 6096 |
| Metal | Ir |
| Oxidation state | 3 |
| Charge | 1 |
| Donor atoms | {"N": 6} |
| Abbreviation | Ir-ppy-Tz |
| SMILES | Cc1nnc(-c2ccc(-c3nc4c5cccnc5c5ncccc5c4n3-c3ccccc3)cc2)nn1.[c-]1ccccc1-c1ccccn1.[c-]1ccccc1-c1ccccn1 |
| Cell line | IC₅₀ dark (µM) | IC₅₀ light (µM) | DOI | Year |
| HeLa | 7 | 0.12 | 10.1039/d4dt01665c | 2024 |
| A549 | 11 | 0.096 | 10.1039/d4dt01665c | 2024 |
| MDA-MB-231 | 12 | 0.1 | 10.1039/d4dt01665c | 2024 |
| HLF | 20 | 0.41 | 10.1039/d4dt01665c | 2024 |
Builds the drawing from source ligand graphs and explicit donor metadata, then uses Metal2D only for layout. Publication output uses black bonds without arrows or colour highlighting; validated octahedral enantiomers are encoded directly with solid and hashed wedge bonds.