| ID | 6072 |
| Metal | Ir |
| Oxidation state | 3 |
| Charge | 1 |
| Donor atoms | {"N": 8} |
| Abbreviation | Ir-NDI |
| SMILES | CCCCN1C(=O)c2c3c(c4c5c(c6nc7c8cccnc8c8ncccc8c7nc6c(c25)C1=O)C(=O)N(CCCC)C4=O)NC(c1ccccc1)(c1ccccc1)N3.Cc1c(C)c(C)[c-](-c2ccc(-c3ccccc3)cc2)c1C.[Cl-] |
| Cell line | IC₅₀ dark (µM) | IC₅₀ light (µM) | DOI | Year |
| 4T1 | 38 | 2 | 10.1039/d3qi02047a | 2024 |
| LO2 | 45 | 4.5 | 10.1039/d3qi02047a | 2024 |
Builds the drawing from source ligand graphs and explicit donor metadata, then uses Metal2D only for layout. Publication output uses black bonds without arrows or colour highlighting; validated octahedral enantiomers are encoded directly with solid and hashed wedge bonds.