| ID | 6044 |
| Metal | Ir |
| Oxidation state | 3 |
| Charge | 1 |
| Donor atoms | {"N": 5} |
| Abbreviation | IrL1 |
| SMILES | CCCCn1c(-c2ccc(Br)cn2)nc2cc(C)ccc21.[c-]1ccccc1-c1ccccn1.[c-]1ccccc1-c1ccccn1 |
| Cell line | IC₅₀ dark (µM) | IC₅₀ light (µM) | DOI | Year |
| A549 | 0.16 | 0.025 | 10.1021/acsabm.5c00393 | 2025 |
| HT-29 | 0.23 | 0.014 | 10.1021/acsabm.5c00393 | 2025 |
| HT-29 | 0.36 | 0.034 | 10.1021/acsabm.5c00393 | 2025 |
| A549 | 0.49 | 0.027 | 10.1021/acsabm.5c00393 | 2025 |
Builds the drawing from source ligand graphs and explicit donor metadata, then uses Metal2D only for layout. Publication output uses black bonds without arrows or colour highlighting; validated octahedral enantiomers are encoded directly with solid and hashed wedge bonds.