Info
| ID | 5863 |
| Metal | Ir |
| Oxidation state | 3 |
| Charge | 1 |
| Donor atoms | {"N": 5} |
| Abbreviation | 8 |
| SMILES | Cc1c(C)c(C)[c-](C)c1C.[c-]1cccc2c1c1ncccc1c1nc3cc4ccccc4cc3nc21.c1ccc(Cn2ccnc2)cc1 |
TUCAN
C43H37IrN5/(1-51)(2-50)(3-38)(4-38)(5-38)(6-39)(7-39)(8-73)(9-45)(10-80)(11-58)(12-59)(13-74)(14-44)(15-57)(16-48)(17-56)(18-53)(19-49)(20-46)(21-71)(22-47)(23-39)(24-40)(25-40)(26-40)(27-41)(28-41)(29-54)(30-72)(31-52)(32-74)(33-55)(34-41)(35-42)(36-42)(37-42)(38-61)(39-62)(40-63)(41-64)(42-65)(43-53)(43-67)(44-45)(44-69)(45-47)(46-60)(46-75)(47-52)(48-49)(48-60)(49-56)(50-56)(50-66)(51-66)(51-78)(52-57)(53-55)(54-55)(54-68)(57-69)(58-59)(58-70)(59-73)(60-66)(61-62)(61-63)(62-64)(63-65)(64-65)(67-68)(67-79)(68-77)(69-74)(70-76)(70-79)(71-72)(71-82)(72-84)(73-85)(74-82)(75-78)(75-83)(76-77)(76-83)(77-81)(78-81)(79-85)(80-82)(80-84)(83-86)(84-86)(85-86)
Measurements (7)
| Cell line | IC₅₀ dark (µM) | IC₅₀ light (µM) | DOI | Year |
| A549 | 0.15 | 0.0002 | 10.1021/acs.jmedchem.3c01276 | 2024 |
| A549 | 0.15 | 0.0021 | 10.1021/acs.jmedchem.3c01276 | 2024 |
| A549 | 0.15 | 0.03 | 10.1021/acs.jmedchem.3c01276 | 2024 |
| 1BR.3.G | 0.5 | 0.0005 | 10.1021/acs.jmedchem.3c01276 | 2024 |
| HeLa | 0.51 | 0.0008 | 10.1021/acs.jmedchem.3c01276 | 2024 |
| PC-3 | 0.64 | 0.0005 | 10.1021/acs.jmedchem.3c01276 | 2024 |
| MRC-5 | 0.68 | 0.0008 | 10.1021/acs.jmedchem.3c01276 | 2024 |
🧬 Cell Death Types (1)
Apoptosis
high
«Consequently, cell death by apoptosis and secondary necrosis is activated.»
Source-assisted 2D generator
Builds the drawing from source ligand graphs and explicit donor metadata, then uses Metal2D only for layout. Publication output uses black bonds without arrows or colour highlighting; validated octahedral enantiomers are encoded directly with solid and hashed wedge bonds.
Loading source metadata…
The generated SVG will appear here. The legacy ligand image above stays visible for side-by-side review.