| ID | 5857 |
| Metal | Ir |
| Oxidation state | 3 |
| Charge | 0 |
| Donor atoms | {"N": 3} |
| Abbreviation | 2 |
| SMILES | Cc1c(C)c(C)[c-](C)c1C.[Cl-].[c-]1cccc2c1c1ncccc1c1nc3cc4ccccc4cc3nc21 |
| Cell line | IC₅₀ dark (µM) | IC₅₀ light (µM) | DOI | Year |
| A549 | 2.2 | 0.0069 | 10.1021/acs.jmedchem.3c01276 | 2024 |
| A549 | 2.2 | 0.032 | 10.1021/acs.jmedchem.3c01276 | 2024 |
| A549 | 2.2 | 0.6 | 10.1021/acs.jmedchem.3c01276 | 2024 |
| HeLa | 2.7 | 0.037 | 10.1021/acs.jmedchem.3c01276 | 2024 |
| PC-3 | 2.7 | 0.0089 | 10.1021/acs.jmedchem.3c01276 | 2024 |
| 1BR.3.G | 3.2 | 0.0062 | 10.1021/acs.jmedchem.3c01276 | 2024 |
| MRC-5 | 3.9 | 0.016 | 10.1021/acs.jmedchem.3c01276 | 2024 |
Builds the drawing from source ligand graphs and explicit donor metadata, then uses Metal2D only for layout. Publication output uses black bonds without arrows or colour highlighting; validated octahedral enantiomers are encoded directly with solid and hashed wedge bonds.