| ID | 5833 |
| Metal | Ir |
| Oxidation state | 3 |
| Charge | 1 |
| Donor atoms | {"N": 7} |
| Abbreviation | NA-Ir |
| SMILES | Cc1ccnc(-c2cc(COC(=O)CCN3C(=O)c4cccc5c([N-][N+]#N)ccc(c45)C3=O)ccn2)c1.[c-]1ccccc1-c1ccccn1.[c-]1ccccc1-c1ccccn1 |
| Cell line | IC₅₀ dark (µM) | IC₅₀ light (µM) | DOI | Year |
| HeLa | 6 | 1.4 | 10.1021/acs.jmedchem.4c01065 | 2024 |
| 143B | 7.3 | 1.6 | 10.1021/acs.jmedchem.4c01065 | 2024 |
| A375 | 8.4 | 1.7 | 10.1021/acs.jmedchem.4c01065 | 2024 |
| HepG2 | 9.5 | 2.4 | 10.1021/acs.jmedchem.4c01065 | 2024 |
| BMSC | 13 | 5 | 10.1021/acs.jmedchem.4c01065 | 2024 |
| EA.hy926 | 14 | 5.3 | 10.1021/acs.jmedchem.4c01065 | 2024 |
Builds the drawing from source ligand graphs and explicit donor metadata, then uses Metal2D only for layout. Publication output uses black bonds without arrows or colour highlighting; validated octahedral enantiomers are encoded directly with solid and hashed wedge bonds.