| ID | 5712 |
| Metal | Ir |
| Oxidation state | 3 |
| Charge | 0 |
| Donor atoms | {"N": 3, "S": 1} |
| Abbreviation | Ir2@DEDTC |
| SMILES | CCN(CC)C(=S)[S-].[c-]1ccsc1-c1ccccn1.[c-]1ccsc1-c1ccccn1 |
| Cell line | IC₅₀ dark (µM) | IC₅₀ light (µM) | DOI | Year |
| HCT-116 | 44 | 0.11 | 10.1021/acs.inorgchem.3c02942 | 2023 |
| HeLa | — | 4.1 | 10.1021/acs.inorgchem.3c02942 | 2023 |
| PC-3 | — | 59 | 10.1021/acs.inorgchem.3c02942 | 2023 |
Builds the drawing from source ligand graphs and explicit donor metadata, then uses Metal2D only for layout. Publication output uses black bonds without arrows or colour highlighting; validated octahedral enantiomers are encoded directly with solid and hashed wedge bonds.