| ID | 5711 |
| Metal | Ir |
| Oxidation state | 3 |
| Charge | 0 |
| Donor atoms | {"S": 1, "N": 2} |
| Abbreviation | Ir1@MEDTC |
| SMILES | COC(=S)[S-].[c-]1ccccc1-c1ccccn1.[c-]1ccccc1-c1ccccn1 |
| Cell line | IC₅₀ dark (µM) | IC₅₀ light (µM) | DOI | Year |
| HCT-116 | 40 | 27 | 10.1021/acs.inorgchem.3c02942 | 2023 |
| PC-3 | 90 | 40 | 10.1021/acs.inorgchem.3c02942 | 2023 |
| HeLa | — | 33 | 10.1021/acs.inorgchem.3c02942 | 2023 |
Builds the drawing from source ligand graphs and explicit donor metadata, then uses Metal2D only for layout. Publication output uses black bonds without arrows or colour highlighting; validated octahedral enantiomers are encoded directly with solid and hashed wedge bonds.