| ID | 5687 |
| Metal | Ir |
| Oxidation state | 3 |
| Charge | 1 |
| Donor atoms | {"N": 5} |
| Abbreviation | 3 |
| SMILES | [c-]1ccccc1-c1ccccn1.[c-]1ccccc1-c1ccccn1.c1ccc2sc(-c3nccc4c3[nH]c3ccccc34)nc2c1 |
| Cell line | IC₅₀ dark (µM) | IC₅₀ light (µM) | DOI | Year |
| HeLa | 1.3 | 0.014 | 10.1016/j.ejmech.2024.116618 | 2024 |
| MCF-7 | 1.3 | 0.012 | 10.1016/j.ejmech.2024.116618 | 2024 |
| A549 | 1.5 | 0.02 | 10.1016/j.ejmech.2024.116618 | 2024 |
| PC-3 | 2.3 | 0.017 | 10.1016/j.ejmech.2024.116618 | 2024 |
| PC-3 | 2.3 | 0.12 | 10.1016/j.ejmech.2024.116618 | 2024 |
| PC-3 | 2.3 | 0.27 | 10.1016/j.ejmech.2024.116618 | 2024 |
| 1BR.3.G | 9.2 | 0.097 | 10.1016/j.ejmech.2024.116618 | 2024 |
Builds the drawing from source ligand graphs and explicit donor metadata, then uses Metal2D only for layout. Publication output uses black bonds without arrows or colour highlighting; validated octahedral enantiomers are encoded directly with solid and hashed wedge bonds.