| ID | 5686 |
| Metal | Ir |
| Oxidation state | 3 |
| Charge | 1 |
| Donor atoms | {"N": 5} |
| Abbreviation | 2 |
| SMILES | Cc1csc(-c2nccc3c2[nH]c2ccccc23)n1.[c-]1ccccc1-c1ccccn1.[c-]1ccccc1-c1ccccn1 |
| Cell line | IC₅₀ dark (µM) | IC₅₀ light (µM) | DOI | Year |
| HeLa | 1.4 | 0.016 | 10.1016/j.ejmech.2024.116618 | 2024 |
| PC-3 | 1.5 | 0.017 | 10.1016/j.ejmech.2024.116618 | 2024 |
| PC-3 | 1.5 | 0.085 | 10.1016/j.ejmech.2024.116618 | 2024 |
| PC-3 | 1.5 | 0.46 | 10.1016/j.ejmech.2024.116618 | 2024 |
| A549 | 2.4 | 0.035 | 10.1016/j.ejmech.2024.116618 | 2024 |
| 1BR.3.G | 4.1 | 0.032 | 10.1016/j.ejmech.2024.116618 | 2024 |
| MCF-7 | 4.2 | 0.021 | 10.1016/j.ejmech.2024.116618 | 2024 |
Builds the drawing from source ligand graphs and explicit donor metadata, then uses Metal2D only for layout. Publication output uses black bonds without arrows or colour highlighting; validated octahedral enantiomers are encoded directly with solid and hashed wedge bonds.