| ID | 5534 |
| Metal | Ir |
| Oxidation state | 3 |
| Charge | 1 |
| Donor atoms | {"N": 6} |
| Abbreviation | 1 |
| SMILES | [c-]1ccccc1-c1ccccn1.[c-]1ccccc1-c1ccccn1.c1ccc2c(c1)[nH]c1c(-c3ncc[nH]3)nccc12 |
| Cell line | IC₅₀ dark (µM) | IC₅₀ light (µM) | DOI | Year |
| A549cisR | 18 | 0.37 | 10.1039/C5SC01955A | 2015 |
| A549 | 20 | 0.88 | 10.1039/C5SC01955A | 2015 |
| LO2 | 24 | 9.8 | 10.1039/C5SC01955A | 2015 |
Builds the drawing from source ligand graphs and explicit donor metadata, then uses Metal2D only for layout. Publication output uses black bonds without arrows or colour highlighting; validated octahedral enantiomers are encoded directly with solid and hashed wedge bonds.