| ID | 5094 |
| Metal | Ir |
| Oxidation state | 3 |
| Charge | 2 |
| Donor atoms | {"N": 6} |
| Abbreviation | 1 |
| SMILES | NC(=[NH2+])Nc1ccc(-c2nc3c4cccnc4c4ncccc4c3[nH]2)cc1.[c-]1cccc2ccc3cccnc3c12.[c-]1cccc2ccc3cccnc3c12 |
| Cell line | IC₅₀ dark (µM) | IC₅₀ light (µM) | DOI | Year |
| A549 | 44 | 0.27 | 10.1016/j.ejmech.2019.06.045 | 2019 |
| LO2 | 45 | 1.7 | 10.1016/j.ejmech.2019.06.045 | 2019 |
| A549cisR | 52 | 0.32 | 10.1016/j.ejmech.2019.06.045 | 2019 |
| HeLa | 59 | 0.33 | 10.1016/j.ejmech.2019.06.045 | 2019 |
| MCF-7 | 66 | 0.71 | 10.1016/j.ejmech.2019.06.045 | 2019 |
| CNE-2 | 1e+02 | 0.39 | 10.1016/j.ejmech.2019.06.045 | 2019 |
| HepG2 | 1.4e+02 | 0.36 | 10.1016/j.ejmech.2019.06.045 | 2019 |
Builds the drawing from source ligand graphs and explicit donor metadata, then uses Metal2D only for layout. Publication output uses black bonds without arrows or colour highlighting; validated octahedral enantiomers are encoded directly with solid and hashed wedge bonds.