| ID | 4960 |
| Metal | Ir |
| Oxidation state | 3 |
| Charge | 1 |
| Donor atoms | {"N": 7} |
| Abbreviation | Ir1 |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3ccccn3)nc(-c3ccccn3)c2)cc(C(C)(C)C)c1.CCN(CC)c1ccc2[c-]c(-c3nc4ccccc4s3)c(=O)oc2c1.CCN(CC)c1ccc2[c-]c(-c3nc4ccccc4s3)c(=O)oc2c1 |
| Cell line | IC₅₀ dark (µM) | IC₅₀ light (µM) | DOI | Year |
| A431 | 1.8 | 0.02 | 10.1002/chem.202103346 | 2021 |
| A431 | 1.8 | 0.1 | 10.1002/chem.202103346 | 2021 |
| HeLa | 13 | 0.3 | 10.1002/chem.202103346 | 2021 |
| HeLa | 13 | 0.4 | 10.1002/chem.202103346 | 2021 |
| NP69 | 14 | 1 | 10.1002/chem.202103346 | 2021 |
| B16 | — | 1.3 | 10.1002/chem.202103346 | 2021 |
Builds the drawing from source ligand graphs and explicit donor metadata, then uses Metal2D only for layout. Publication output uses black bonds without arrows or colour highlighting; validated octahedral enantiomers are encoded directly with solid and hashed wedge bonds.