| ID | 369 |
| Metal | Ru |
| Oxidation state | 2 |
| Charge | 1 |
| Donor atoms | {"N": 7} |
| Abbreviation | 3d |
| SMILES | [c-]1cccc2c1c1ncccc1c1nc(-c3ccccc3)[nH]c21.c1ccc(-c2ccccn2)nc1.c1ccc(-c2ccccn2)nc1 |
| Cell line | IC₅₀ dark (µM) | IC₅₀ light (µM) | DOI | Year |
| KATO III | 0.52 | 0.5 | 10.1016/j.jinorgbio.2020.11108... | 2020 |
| AGS | 0.85 | 0.67 | 10.1016/j.jinorgbio.2020.11108... | 2020 |
| HeLa | 58 | 6.4 | 10.1039/d0dt01684e | 2020 |
Builds the drawing from source ligand graphs and explicit donor metadata, then uses Metal2D only for layout. Publication output uses black bonds without arrows or colour highlighting; validated octahedral enantiomers are encoded directly with solid and hashed wedge bonds.