| ID | 3248 |
| Metal | Ru |
| Oxidation state | 2 |
| Charge | 2 |
| Donor atoms | {"N": 7} |
| Abbreviation | 6 |
| SMILES | c1ccc(-c2ccccn2)nc1.c1ccc(-c2ccccn2)nc1.c1ccc2sc(-c3nccc4c3[nH]c3ccccc34)nc2c1 |
| Cell line | IC₅₀ dark (µM) | IC₅₀ light (µM) | DOI | Year |
| MCF-7 | 28 | 1.4 | 10.1016/j.ejmech.2024.116618 | 2024 |
| A549 | 35 | 1.8 | 10.1016/j.ejmech.2024.116618 | 2024 |
| PC-3 | 39 | 3.3 | 10.1016/j.ejmech.2024.116618 | 2024 |
| PC-3 | 39 | 5.5 | 10.1016/j.ejmech.2024.116618 | 2024 |
| PC-3 | 39 | 14 | 10.1016/j.ejmech.2024.116618 | 2024 |
| HeLa | 57 | 1.3 | 10.1016/j.ejmech.2024.116618 | 2024 |
| 1BR.3.G | 93 | 3.7 | 10.1016/j.ejmech.2024.116618 | 2024 |
Builds the drawing from source ligand graphs and explicit donor metadata, then uses Metal2D only for layout. Publication output uses black bonds without arrows or colour highlighting; validated octahedral enantiomers are encoded directly with solid and hashed wedge bonds.