Info
| ID | 3228 |
| Metal | Ru |
| Oxidation state | 2 |
| Charge | 1 |
| Donor atoms | {"N": 8} |
| Abbreviation | RuL3 |
| SMILES | CN(C)c1c[c-]c(-c2nc3cc4ccccc4cc3nc2-c2ccc(N(C)C)cc2)cc1.c1cnc2c(c1)ccc1cccnc12.c1cnc2c(c1)ccc1cccnc12 |
TUCAN
C52H41N8Ru/(1-45)(2-44)(3-43)(4-58)(5-60)(6-62)(7-55)(8-67)(9-52)(10-80)(11-46)(12-57)(13-81)(14-82)(15-64)(16-51)(17-53)(18-78)(19-78)(20-78)(21-79)(22-79)(23-48)(24-50)(25-56)(26-76)(27-76)(28-83)(29-54)(30-47)(31-61)(32-66)(33-49)(34-65)(35-76)(36-77)(37-77)(38-77)(39-63)(40-59)(41-79)(42-59)(42-75)(43-46)(43-68)(44-45)(44-80)(45-68)(46-69)(47-49)(47-70)(48-60)(48-69)(49-73)(50-64)(50-70)(51-57)(51-75)(52-53)(52-71)(53-86)(54-56)(54-86)(55-58)(55-67)(56-71)(57-85)(58-61)(59-85)(60-81)(61-72)(62-74)(62-90)(63-65)(63-73)(64-82)(65-83)(66-72)(66-93)(67-74)(68-84)(69-88)(70-89)(71-87)(72-74)(73-92)(75-91)(76-94)(77-94)(78-95)(79-95)(80-96)(81-97)(82-99)(83-100)(84-88)(84-96)(85-95)(86-94)(87-91)(87-98)(88-97)(89-92)(89-99)(90-93)(90-98)(91-101)(92-100)(93-101)(96-102)(97-102)(98-102)(99-102)(100-102)(101-102)
Measurements (7)
| Cell line | IC₅₀ dark (µM) | IC₅₀ light (µM) | DOI | Year |
| HCT-116 | 1.1 | 0.013 | 10.1021/acs.jmedchem.4c02357 | 2024 |
| HCT-116 | 1.1 | 0.06 | 10.1021/acs.jmedchem.4c02357 | 2024 |
| A375 | 1.3 | 0.022 | 10.1021/acs.jmedchem.4c02357 | 2024 |
| A375 | 1.3 | 0.06 | 10.1021/acs.jmedchem.4c02357 | 2024 |
| HeLa | 2.5 | 0.033 | 10.1021/acs.jmedchem.4c02357 | 2024 |
| HeLa | 2.5 | 0.14 | 10.1021/acs.jmedchem.4c02357 | 2024 |
| MRC5pd30 | 9.3 | — | 10.1021/acs.jmedchem.4c02357 | 2024 |
🧬 Cell Death Types (1)
Apoptosis
high
«the result suggests a caspase-dependent apoptosis as the predominant mode of cell death»
Source-assisted 2D generator
Builds the drawing from source ligand graphs and explicit donor metadata, then uses Metal2D only for layout. Publication output uses black bonds without arrows or colour highlighting; validated octahedral enantiomers are encoded directly with solid and hashed wedge bonds.
Loading source metadata…
The generated SVG will appear here. The legacy ligand image above stays visible for side-by-side review.