| ID | 2675 |
| Metal | Ru |
| Oxidation state | 2 |
| Charge | 1 |
| Donor atoms | {"N": 2} |
| Abbreviation | RuBQ |
| SMILES | Cc1ccc(C(C)C)cc1.[Cl-].c1ccc2cc(-c3ccc4ccccc4n3)ncc2c1 |
| Cell line | IC₅₀ dark (µM) | IC₅₀ light (µM) | DOI | Year |
| MCF-7 | 20 | 9.4 | 10.1039/d3dt01348k | 2023 |
| HeLa | 24 | 10 | 10.1039/d3dt01348k | 2023 |
Builds the drawing from source ligand graphs and explicit donor metadata, then uses Metal2D only for layout. Publication output uses black bonds without arrows or colour highlighting; validated octahedral enantiomers are encoded directly with solid and hashed wedge bonds.