| ID | 2189 |
| Metal | Ru |
| Oxidation state | 2 |
| Charge | 3 |
| Donor atoms | {"N": 6} |
| Abbreviation | 2 |
| SMILES | NC(=[NH2+])Nc1cccc(-c2nc3c4cccnc4c4ncccc4c3[nH]2)c1.c1cnc2c(c1)ccc1cccnc12.c1cnc2c(c1)ccc1cccnc12 |
| Cell line | IC₅₀ dark (µM) | IC₅₀ light (µM) | DOI | Year |
| HeLa | 40 | 1.2 | 10.1016/j.jinorgbio.2016.09.00... | 2016 |
| MCF-7 | 40 | 1.8 | 10.1016/j.jinorgbio.2016.09.00... | 2016 |
| A549 | 43 | 0.41 | 10.1016/j.jinorgbio.2016.09.00... | 2016 |
| LO2 | 68 | 81 | 10.1016/j.jinorgbio.2016.09.00... | 2016 |
| CNE-2 | 69 | 7.9 | 10.1016/j.jinorgbio.2016.09.00... | 2016 |
| HepG2 | 76 | 2.5 | 10.1016/j.jinorgbio.2016.09.00... | 2016 |
Builds the drawing from source ligand graphs and explicit donor metadata, then uses Metal2D only for layout. Publication output uses black bonds without arrows or colour highlighting; validated octahedral enantiomers are encoded directly with solid and hashed wedge bonds.